ChemNet > CAS > 78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
| product Name |
2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile |
| CAS No |
78940-73-5 |
| Synonyms |
2-[(4-chlorophenyl)sulfanyl]-5-nitrobenzonitrile |
| Molecular Formula |
C13H7ClN2O2S |
| Molecular Weight |
290.7249 |
| InChI |
InChI=1/C13H7ClN2O2S/c14-10-1-4-12(5-2-10)19-13-6-3-11(16(17)18)7-9(13)8-15/h1-7H |
| Molecular Structure |
![78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile](https://images-a.chemnet.com/suppliers/chembase/116/11671.gif)
|
| Density |
1.47g/cm3 |
| Melting point |
167℃ |
| Boiling point |
452.8°C at 760 mmHg |
| Refractive index |
1.685 |
| Flash point |
227.6°C |
| Vapour Pressur |
2.18E-08mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
| MSDS |
Material Safety Data Sheet
|
|
